ethyl 3-iodobenzoate


ethyl 3-iodobenzoate
CAS RN:[58313-23-8]
Formula:C9H9IO2; 276.07 g/mol
InChiKey:POGCXCWRMMXDAQ-UHFFFAOYSA-N
SMILES:CCOC(=O)c1cccc(I)c1
Molecular structure of ethyl 3-iodobenzoate
Density:1.640 g/mL
Molar volume:168.3 mL/mol
Refractive index:1.582
Molecular refractive power:56.14 mL/mol
Boiling point:272 °C

Isomers

ethyl 2-iodobenzoate
Molecular structure of ethyl 2-iodobenzoate
ethyl 3-iodobenzoate
Molecular structure of ethyl 3-iodobenzoate
ethyl 4-iodobenzoate
Molecular structure of ethyl 4-iodobenzoate
2-iodo-4,5-dimethylbenzoic acid
Molecular structure of 2-iodo-4,5-dimethylbenzoic acid
3'-iodo-4'-methoxyacetophenone
Molecular structure of 3'-iodo-4'-methoxyacetophenone
3-(2-iodophenyl)propionic acid
Molecular structure of 3-(2-iodophenyl)propionic acid
methyl 2-iodo-5-methylbenzoate
Molecular structure of methyl 2-iodo-5-methylbenzoate
methyl 3-iodo-4-methylbenzoate
Molecular structure of methyl 3-iodo-4-methylbenzoate
methyl 4-iodo-3-methylbenzoate
Molecular structure of methyl 4-iodo-3-methylbenzoate